C14H13Cl3N2 — CID 102061109
4-[[4-methyl-4-(trichloromethyl)cyclohexa-2,5-dien-1-ylidene]amino]aniline (PubChem CID 102061109) has the molecular formula C14H13Cl3N2 and a molecular weight of 315.63 g/mol. Its IUPAC name is 4-[[4-methyl-4-(trichloromethyl)cyclohexa-2,5-dien-1-ylidene]amino]aniline.
| Compound Name | 4-[[4-methyl-4-(trichloromethyl)cyclohexa-2,5-dien-1-ylidene]amino]aniline |
|---|---|
| PubChem CID | 102061109 |
| Molecular Formula | C14H13Cl3N2 |
| Molecular Weight | 315.63 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | 4-[[4-methyl-4-(trichloromethyl)cyclohexa-2,5-dien-1-ylidene]amino]aniline |
| SMILES | CC1(C(Cl)(Cl)Cl)C=CC(=Nc2ccc(N)cc2)C=C1 |
| InChI | InChI=1S/C14H13Cl3N2/c1-13(14(15,16)17)8-6-12(7-9-13)19-11-4-2-10(18)3-5-11/h2-9H,18H2,1H3/b19-12- |
| InChIKey | YHNPQCDCWLPOAJ-UNOMPAQXSA-N |
| XLogP | 4.84 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.63 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|