C22H28N4O — CID 90947771
4-N-hexan-3-yloxy-4-N-(2-phenylethyl)quinazoline-4,6-diamine (PubChem CID 90947771) has the molecular formula C22H28N4O and a molecular weight of 364.49 g/mol. Its IUPAC name is 4-N-hexan-3-yloxy-4-N-(2-phenylethyl)quinazoline-4,6-diamine.
| Compound Name | 4-N-hexan-3-yloxy-4-N-(2-phenylethyl)quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 90947771 |
| Molecular Formula | C22H28N4O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | 4-N-hexan-3-yloxy-4-N-(2-phenylethyl)quinazoline-4,6-diamine |
| SMILES | CCCC(CC)ON(CCc1ccccc1)c1ncnc2ccc(N)cc12 |
| InChI | InChI=1S/C22H28N4O/c1-3-8-19(4-2)27-26(14-13-17-9-6-5-7-10-17)22-20-15-18(23)11-12-21(20)24-16-25-22/h5-7,9-12,15-16,19H,3-4,8,13-14,23H2,1-2H3 |
| InChIKey | QBGFVMMZAMETAN-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|