C24H41N3O — CID 90949805
N'-(2-decoxy-2-phenylethyl)piperidine-1-carboximidamide (PubChem CID 90949805) has the molecular formula C24H41N3O and a molecular weight of 387.61 g/mol. Its IUPAC name is N'-(2-decoxy-2-phenylethyl)piperidine-1-carboximidamide.
| Compound Name | N'-(2-decoxy-2-phenylethyl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 90949805 |
| Molecular Formula | C24H41N3O |
| Molecular Weight | 387.61 g/mol |
| Exact Mass | 387.32 |
| IUPAC Name | N'-(2-decoxy-2-phenylethyl)piperidine-1-carboximidamide |
| SMILES | CCCCCCCCCCOC(C/N=C(\N)N1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C24H41N3O/c1-2-3-4-5-6-7-8-15-20-28-23(22-16-11-9-12-17-22)21-26-24(25)27-18-13-10-14-19-27/h9,11-12,16-17,23H,2-8,10,13-15,18-21H2,1H3,(H2,25,26) |
| InChIKey | XXOJNUGCWOKGTG-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.61 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|