About (2,3-dimethyl-2,3-dihydrothiophen-5-yl)methanol
(2,3-dimethyl-2,3-dihydrothiophen-5-yl)methanol (PubChem CID 90956335) has the molecular formula C7H12OS
and a molecular weight of 144.24 g/mol. Its IUPAC name is (2,3-dimethyl-2,3-dihydrothiophen-5-yl)methanol.
Analyze (2,3-dimethyl-2,3-dihydrothiophen-5-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3-dimethyl-2,3-dihydrothiophen-5-yl)methanol?
The IUPAC name of (2,3-dimethyl-2,3-dihydrothiophen-5-yl)methanol (CID 90956335) is (2,3-dimethyl-2,3-dihydrothiophen-5-yl)methanol.
What is the SMILES notation for (2,3-dimethyl-2,3-dihydrothiophen-5-yl)methanol?
The canonical SMILES for (2,3-dimethyl-2,3-dihydrothiophen-5-yl)methanol is CC1C=C(CO)SC1C.
What is the InChIKey of (2,3-dimethyl-2,3-dihydrothiophen-5-yl)methanol?
The InChIKey is VTCNGDSSHBHMCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12OS/c1-5-3-7(4-8)9-6(5)2/h3,5-6,8H,4H2,1-2H3.
What are the key properties of (2,3-dimethyl-2,3-dihydrothiophen-5-yl)methanol?
(2,3-dimethyl-2,3-dihydrothiophen-5-yl)methanol has a molecular weight of 144.24 g/mol, XLogP of 1.63, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-dimethyl-2,3-dihydrothiophen-5-yl)methanol is sourced from PubChem (CID 90956335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).