C25H25Cl2N3O5 — CID 90957183
N-[6-chloro-4-(3-propan-2-yloxyprop-1-ynyl)-1,3-benzodioxol-2-yl]-7-(3-chloropropoxy)-6-methoxyquinazolin-4-amine (PubChem CID 90957183) has the molecular formula C25H25Cl2N3O5 and a molecular weight of 518.40 g/mol. Its IUPAC name is N-[6-chloro-4-(3-propan-2-yloxyprop-1-ynyl)-1,3-benzodioxol-2-yl]-7-(3-chloropropoxy)-6-methoxyquinazolin-4-amine.
| Compound Name | N-[6-chloro-4-(3-propan-2-yloxyprop-1-ynyl)-1,3-benzodioxol-2-yl]-7-(3-chloropropoxy)-6-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 90957183 |
| Molecular Formula | C25H25Cl2N3O5 |
| Molecular Weight | 518.40 g/mol |
| Exact Mass | 517.12 |
| IUPAC Name | N-[6-chloro-4-(3-propan-2-yloxyprop-1-ynyl)-1,3-benzodioxol-2-yl]-7-(3-chloropropoxy)-6-methoxyquinazolin-4-amine |
| SMILES | COc1cc2c(NC3Oc4cc(Cl)cc(C#CCOC(C)C)c4O3)ncnc2cc1OCCCCl |
| InChI | InChI=1S/C25H25Cl2N3O5/c1-15(2)32-8-4-6-16-10-17(27)11-22-23(16)35-25(34-22)30-24-18-12-20(31-3)21(33-9-5-7-26)13-19(18)28-14-29-24/h10-15,25H,5,7-9H2,1-3H3,(H,28,29,30) |
| InChIKey | VBWUWSZQFOXSPQ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.40 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|