C21H18O8 — CID 90957989
[2-[3-(1,3-benzodioxol-5-yloxy)-3-oxoprop-1-enyl]-1,3-benzodioxol-5-yl] butanoate (PubChem CID 90957989) has the molecular formula C21H18O8 and a molecular weight of 398.37 g/mol. Its IUPAC name is [2-[3-(1,3-benzodioxol-5-yloxy)-3-oxoprop-1-enyl]-1,3-benzodioxol-5-yl] butanoate.
| Compound Name | [2-[3-(1,3-benzodioxol-5-yloxy)-3-oxoprop-1-enyl]-1,3-benzodioxol-5-yl] butanoate |
|---|---|
| PubChem CID | 90957989 |
| Molecular Formula | C21H18O8 |
| Molecular Weight | 398.37 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | [2-[3-(1,3-benzodioxol-5-yloxy)-3-oxoprop-1-enyl]-1,3-benzodioxol-5-yl] butanoate |
| SMILES | CCCC(=O)Oc1ccc2c(c1)OC(C=CC(=O)Oc1ccc3c(c1)OCO3)O2 |
| InChI | InChI=1S/C21H18O8/c1-2-3-19(22)26-14-5-7-16-18(11-14)29-21(28-16)9-8-20(23)27-13-4-6-15-17(10-13)25-12-24-15/h4-11,21H,2-3,12H2,1H3 |
| InChIKey | IPVGPSKPLAKVML-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|