About ditert-butyl [(2R)-5-(4-heptoxyphenyl)-3-methylpentan-2-yl] phosphate
ditert-butyl [(2R)-5-(4-heptoxyphenyl)-3-methylpentan-2-yl] phosphate (PubChem CID 90960881) has the molecular formula C27H49O5P
and a molecular weight of 484.66 g/mol. Its IUPAC name is ditert-butyl [(2R)-5-(4-heptoxyphenyl)-3-methylpentan-2-yl] phosphate.
Molecular Properties
| Compound Name | ditert-butyl [(2R)-5-(4-heptoxyphenyl)-3-methylpentan-2-yl] phosphate |
| PubChem CID | 90960881 |
| Molecular Formula | C27H49O5P |
| Molecular Weight | 484.66 g/mol |
| Exact Mass | 484.33 |
| IUPAC Name | ditert-butyl [(2R)-5-(4-heptoxyphenyl)-3-methylpentan-2-yl] phosphate |
| SMILES | CCCCCCCOc1ccc(CCC(C)[C@@H](C)OP(=O)(OC(C)(C)C)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C27H49O5P/c1-10-11-12-13-14-21-29-25-19-17-24(18-20-25)16-15-22(2)23(3)30-33(28,31-26(4,5)6)32-27(7,8)9/h17-20,22-23H,10-16,21H2,1-9H3/t22?,23-/m1/s1 |
| InChIKey | UHCAFNZTNPJISJ-OZAIVSQSSA-N |
| XLogP | 8.75 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 484.66 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl [(2R)-5-(4-heptoxyphenyl)-3-methylpentan-2-yl] phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl [(2R)-5-(4-heptoxyphenyl)-3-methylpentan-2-yl] phosphate?
The IUPAC name of ditert-butyl [(2R)-5-(4-heptoxyphenyl)-3-methylpentan-2-yl] phosphate (CID 90960881) is ditert-butyl [(2R)-5-(4-heptoxyphenyl)-3-methylpentan-2-yl] phosphate.
What is the SMILES notation for ditert-butyl [(2R)-5-(4-heptoxyphenyl)-3-methylpentan-2-yl] phosphate?
The canonical SMILES for ditert-butyl [(2R)-5-(4-heptoxyphenyl)-3-methylpentan-2-yl] phosphate is CCCCCCCOc1ccc(CCC(C)[C@@H](C)OP(=O)(OC(C)(C)C)OC(C)(C)C)cc1.
What is the InChIKey of ditert-butyl [(2R)-5-(4-heptoxyphenyl)-3-methylpentan-2-yl] phosphate?
The InChIKey is UHCAFNZTNPJISJ-OZAIVSQSSA-N. The full InChI is InChI=1S/C27H49O5P/c1-10-11-12-13-14-21-29-25-19-17-24(18-20-25)16-15-22(2)23(3)30-33(28,31-26(4,5)6)32-27(7,8)9/h17-20,22-23H,10-16,21H2,1-9H3/t22?,23-/m1/s1.
What are the key properties of ditert-butyl [(2R)-5-(4-heptoxyphenyl)-3-methylpentan-2-yl] phosphate?
ditert-butyl [(2R)-5-(4-heptoxyphenyl)-3-methylpentan-2-yl] phosphate has a molecular weight of 484.66 g/mol, XLogP of 8.75, 15 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl [(2R)-5-(4-heptoxyphenyl)-3-methylpentan-2-yl] phosphate is sourced from PubChem (CID 90960881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).