C16H32N2O3SSi — CID 90961507
2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3,3-trimethyl-4-(2-sulfinohydrazinyl)cyclohexa-1,4-diene (PubChem CID 90961507) has the molecular formula C16H32N2O3SSi and a molecular weight of 360.60 g/mol. Its IUPAC name is 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3,3-trimethyl-4-(2-sulfinohydrazinyl)cyclohexa-1,4-diene.
| Compound Name | 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3,3-trimethyl-4-(2-sulfinohydrazinyl)cyclohexa-1,4-diene |
|---|---|
| PubChem CID | 90961507 |
| Molecular Formula | C16H32N2O3SSi |
| Molecular Weight | 360.60 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3,3-trimethyl-4-(2-sulfinohydrazinyl)cyclohexa-1,4-diene |
| SMILES | CC1=C(CO[Si](C)(C)C(C)(C)C)C(C)(C)C(NNS(=O)O)=CC1 |
| InChI | InChI=1S/C16H32N2O3SSi/c1-12-9-10-14(17-18-22(19)20)16(5,6)13(12)11-21-23(7,8)15(2,3)4/h10,17-18H,9,11H2,1-8H3,(H,19,20) |
| InChIKey | SDFRGHUSNPVNMQ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.60 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|