C13H27N2O3SSi- — CID 91802867
1-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(2-sulfinatohydrazinyl)cyclohexene (PubChem CID 91802867) has the molecular formula C13H27N2O3SSi- and a molecular weight of 319.52 g/mol. Its IUPAC name is 1-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(2-sulfinatohydrazinyl)cyclohexene.
| Compound Name | 1-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(2-sulfinatohydrazinyl)cyclohexene |
|---|---|
| PubChem CID | 91802867 |
| Molecular Formula | C13H27N2O3SSi- |
| Molecular Weight | 319.52 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 1-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(2-sulfinatohydrazinyl)cyclohexene |
| SMILES | CC(C)(C)[Si](C)(C)OCC1=C(NNS(=O)[O-])CCCC1 |
| InChI | InChI=1S/C13H28N2O3SSi/c1-13(2,3)20(4,5)18-10-11-8-6-7-9-12(11)14-15-19(16)17/h14-15H,6-10H2,1-5H3,(H,16,17)/p-1 |
| InChIKey | GHQAIXSJXGXKSG-UHFFFAOYSA-M |
| XLogP | 2.72 |
| TPSA | 73.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.52 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|