C17H26N3O2S+ — CID 9096539
1-(1,3-benzodioxol-5-ylmethyl)-3-(1-propylpiperidin-1-ium-4-yl)thiourea (PubChem CID 9096539) has the molecular formula C17H26N3O2S+ and a molecular weight of 336.48 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-(1-propylpiperidin-1-ium-4-yl)thiourea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-(1-propylpiperidin-1-ium-4-yl)thiourea |
|---|---|
| PubChem CID | 9096539 |
| Molecular Formula | C17H26N3O2S+ |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-(1-propylpiperidin-1-ium-4-yl)thiourea |
| SMILES | CCC[NH+]1CCC(NC(=S)NCc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C17H25N3O2S/c1-2-7-20-8-5-14(6-9-20)19-17(23)18-11-13-3-4-15-16(10-13)22-12-21-15/h3-4,10,14H,2,5-9,11-12H2,1H3,(H2,18,19,23)/p+1 |
| InChIKey | HNISONFGVYWDRQ-UHFFFAOYSA-O |
| XLogP | 0.84 |
| TPSA | 46.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|