C23H36O9 — CID 90966072
[2-[(4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl)oxy]-2-oxoethyl] 2-tert-butyl-2,4,4-trimethylpentanoate (PubChem CID 90966072) has the molecular formula C23H36O9 and a molecular weight of 456.53 g/mol. Its IUPAC name is [2-[(4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl)oxy]-2-oxoethyl] 2-tert-butyl-2,4,4-trimethylpentanoate.
| Compound Name | [2-[(4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl)oxy]-2-oxoethyl] 2-tert-butyl-2,4,4-trimethylpentanoate |
|---|---|
| PubChem CID | 90966072 |
| Molecular Formula | C23H36O9 |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | [2-[(4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl)oxy]-2-oxoethyl] 2-tert-butyl-2,4,4-trimethylpentanoate |
| SMILES | CC(C)(C)CC(C)(C(=O)OCC(=O)OC1C(=O)OC2C3OC(C)(C)OC3OC12)C(C)(C)C |
| InChI | InChI=1S/C23H36O9/c1-20(2,3)11-23(9,21(4,5)6)19(26)27-10-12(24)28-15-13-14(29-17(15)25)16-18(30-13)32-22(7,8)31-16/h13-16,18H,10-11H2,1-9H3 |
| InChIKey | UMQHHJMPMPZAQS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|