C22H27N2O+ — CID 90966746
2-(1-ethyl-3,3-dimethylindol-1-ium-2-yl)-N-(2-methoxyphenyl)propan-1-imine (PubChem CID 90966746) has the molecular formula C22H27N2O+ and a molecular weight of 335.47 g/mol. Its IUPAC name is 2-(1-ethyl-3,3-dimethylindol-1-ium-2-yl)-N-(2-methoxyphenyl)propan-1-imine.
| Compound Name | 2-(1-ethyl-3,3-dimethylindol-1-ium-2-yl)-N-(2-methoxyphenyl)propan-1-imine |
|---|---|
| PubChem CID | 90966746 |
| Molecular Formula | C22H27N2O+ |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | 2-(1-ethyl-3,3-dimethylindol-1-ium-2-yl)-N-(2-methoxyphenyl)propan-1-imine |
| SMILES | CC[N+]1=C(C(C)/C=N/c2ccccc2OC)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C22H27N2O/c1-6-24-19-13-9-7-11-17(19)22(3,4)21(24)16(2)15-23-18-12-8-10-14-20(18)25-5/h7-16H,6H2,1-5H3/q+1/b23-15+ |
| InChIKey | WLKBCDMOVKZDFQ-HZHRSRAPSA-N |
| XLogP | 5.13 |
| TPSA | 24.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|