C48H60N12O4+4 — CID 90967936
5,10,15,20-tetrakis[3-(2-methoxyethyl)-4-methyl-1H-imidazol-3-ium-2-yl]-21,22,23,24-tetrahydroporphyrin (PubChem CID 90967936) has the molecular formula C48H60N12O4+4 and a molecular weight of 869.09 g/mol. Its IUPAC name is 5,10,15,20-tetrakis[3-(2-methoxyethyl)-4-methyl-1H-imidazol-3-ium-2-yl]-21,22,23,24-tetrahydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis[3-(2-methoxyethyl)-4-methyl-1H-imidazol-3-ium-2-yl]-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 90967936 |
| Molecular Formula | C48H60N12O4+4 |
| Molecular Weight | 869.09 g/mol |
| Exact Mass | 868.48 |
| IUPAC Name | 5,10,15,20-tetrakis[3-(2-methoxyethyl)-4-methyl-1H-imidazol-3-ium-2-yl]-21,22,23,24-tetrahydroporphyrin |
| SMILES | COCC[n+]1c(C)c[nH]c1C1=c2ccc([nH]2)=C(c2[nH]cc(C)[n+]2CCOC)c2ccc([nH]2)C(c2[nH]cc(C)[n+]2CCOC)=c2ccc([nH]2)=C(c2[nH]cc(C)[n+]2CCOC)c2ccc1[nH]2 |
| InChI | InChI=1S/C48H56N12O4/c1-29-25-49-45(57(29)17-21-61-5)41-33-9-11-35(53-33)42(46-50-26-30(2)58(46)18-22-62-6)37-13-15-39(55-37)44(48-52-28-32(4)60(48)20-24-64-8)40-16-14-38(56-40)43(36-12-10-34(41)54-36)47-51-27-31(3)59(47)19-23-63-7/h9-16,25-28H,17-24H2,1-8H3,(H4,49,50,51,52,53,54,55,56)/p+4 |
| InChIKey | CZNBFNXHONOXOF-UHFFFAOYSA-R |
| XLogP | 0.58 |
| TPSA | 178.76 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 869.09 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|