C23H36FNO2 — CID 90969654
1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-3-[[2-(4-ethenyl-4-fluorocyclohexyl)-2-oxoethyl]amino]propan-1-one (PubChem CID 90969654) has the molecular formula C23H36FNO2 and a molecular weight of 377.54 g/mol. Its IUPAC name is 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-3-[[2-(4-ethenyl-4-fluorocyclohexyl)-2-oxoethyl]amino]propan-1-one.
| Compound Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-3-[[2-(4-ethenyl-4-fluorocyclohexyl)-2-oxoethyl]amino]propan-1-one |
|---|---|
| PubChem CID | 90969654 |
| Molecular Formula | C23H36FNO2 |
| Molecular Weight | 377.54 g/mol |
| Exact Mass | 377.27 |
| IUPAC Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-3-[[2-(4-ethenyl-4-fluorocyclohexyl)-2-oxoethyl]amino]propan-1-one |
| SMILES | C=CC1(F)CCC(C(=O)CNCCC(=O)C2CCCC3CCCCC32)CC1 |
| InChI | InChI=1S/C23H36FNO2/c1-2-23(24)13-10-18(11-14-23)22(27)16-25-15-12-21(26)20-9-5-7-17-6-3-4-8-19(17)20/h2,17-20,25H,1,3-16H2 |
| InChIKey | MHFNKIXISBGHCH-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.54 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|