C12H11ClF3N3O3 — CID 90970895
[1-(3-chloro-2-pyridinyl)-4-ethyl-3-(trifluoromethyl)pyrazol-5-yl]-hydroperoxymethanol (PubChem CID 90970895) has the molecular formula C12H11ClF3N3O3 and a molecular weight of 337.69 g/mol. Its IUPAC name is [1-(3-chloro-2-pyridinyl)-4-ethyl-3-(trifluoromethyl)pyrazol-5-yl]-hydroperoxymethanol.
| Compound Name | [1-(3-chloro-2-pyridinyl)-4-ethyl-3-(trifluoromethyl)pyrazol-5-yl]-hydroperoxymethanol |
|---|---|
| PubChem CID | 90970895 |
| Molecular Formula | C12H11ClF3N3O3 |
| Molecular Weight | 337.69 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | [1-(3-chloro-2-pyridinyl)-4-ethyl-3-(trifluoromethyl)pyrazol-5-yl]-hydroperoxymethanol |
| SMILES | CCc1c(C(F)(F)F)nn(-c2ncccc2Cl)c1C(O)OO |
| InChI | InChI=1S/C12H11ClF3N3O3/c1-2-6-8(11(20)22-21)19(18-9(6)12(14,15)16)10-7(13)4-3-5-17-10/h3-5,11,20-21H,2H2,1H3 |
| InChIKey | PZVFHFCHYXTVPK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.69 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|