C23H23NO3 — CID 90971150
1-phenacylspiro[4H-isoquinoline-3,4'-cyclohexane]-1'-carboxylic acid (PubChem CID 90971150) has the molecular formula C23H23NO3 and a molecular weight of 361.44 g/mol. Its IUPAC name is 1-phenacylspiro[4H-isoquinoline-3,4'-cyclohexane]-1'-carboxylic acid.
| Compound Name | 1-phenacylspiro[4H-isoquinoline-3,4'-cyclohexane]-1'-carboxylic acid |
|---|---|
| PubChem CID | 90971150 |
| Molecular Formula | C23H23NO3 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 1-phenacylspiro[4H-isoquinoline-3,4'-cyclohexane]-1'-carboxylic acid |
| SMILES | O=C(CC1=NC2(CCC(C(=O)O)CC2)Cc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C23H23NO3/c25-21(16-6-2-1-3-7-16)14-20-19-9-5-4-8-18(19)15-23(24-20)12-10-17(11-13-23)22(26)27/h1-9,17H,10-15H2,(H,26,27) |
| InChIKey | LTEJYMCDHUMEPX-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |