About 3-oxopropyl 5-methyl-2-methylidene-4-oxohex-5-enoate
3-oxopropyl 5-methyl-2-methylidene-4-oxohex-5-enoate (PubChem CID 90974332) has the molecular formula C11H14O4
and a molecular weight of 210.23 g/mol. Its IUPAC name is 3-oxopropyl 5-methyl-2-methylidene-4-oxohex-5-enoate.
Molecular Properties
| Compound Name | 3-oxopropyl 5-methyl-2-methylidene-4-oxohex-5-enoate |
| PubChem CID | 90974332 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 3-oxopropyl 5-methyl-2-methylidene-4-oxohex-5-enoate |
| SMILES | C=C(C)C(=O)CC(=C)C(=O)OCCC=O |
| InChI | InChI=1S/C11H14O4/c1-8(2)10(13)7-9(3)11(14)15-6-4-5-12/h5H,1,3-4,6-7H2,2H3 |
| InChIKey | SMIJVHAUGDDLBW-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-oxopropyl 5-methyl-2-methylidene-4-oxohex-5-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxopropyl 5-methyl-2-methylidene-4-oxohex-5-enoate?
The IUPAC name of 3-oxopropyl 5-methyl-2-methylidene-4-oxohex-5-enoate (CID 90974332) is 3-oxopropyl 5-methyl-2-methylidene-4-oxohex-5-enoate.
What is the SMILES notation for 3-oxopropyl 5-methyl-2-methylidene-4-oxohex-5-enoate?
The canonical SMILES for 3-oxopropyl 5-methyl-2-methylidene-4-oxohex-5-enoate is C=C(C)C(=O)CC(=C)C(=O)OCCC=O.
What is the InChIKey of 3-oxopropyl 5-methyl-2-methylidene-4-oxohex-5-enoate?
The InChIKey is SMIJVHAUGDDLBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O4/c1-8(2)10(13)7-9(3)11(14)15-6-4-5-12/h5H,1,3-4,6-7H2,2H3.
What are the key properties of 3-oxopropyl 5-methyl-2-methylidene-4-oxohex-5-enoate?
3-oxopropyl 5-methyl-2-methylidene-4-oxohex-5-enoate has a molecular weight of 210.23 g/mol, XLogP of 1.21, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxopropyl 5-methyl-2-methylidene-4-oxohex-5-enoate is sourced from PubChem (CID 90974332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).