C7H10O4S — CID 18466429
3-sulfonylpropyl 2-methylprop-2-enoate (PubChem CID 18466429) has the molecular formula C7H10O4S and a molecular weight of 190.22 g/mol. Its IUPAC name is 3-sulfonylpropyl 2-methylprop-2-enoate.
| Compound Name | 3-sulfonylpropyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 18466429 |
| Molecular Formula | C7H10O4S |
| Molecular Weight | 190.22 g/mol |
| Exact Mass | 190.03 |
| IUPAC Name | 3-sulfonylpropyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC=S(=O)=O |
| InChI | InChI=1S/C7H10O4S/c1-6(2)7(8)11-4-3-5-12(9)10/h5H,1,3-4H2,2H3 |
| InChIKey | VIFCUYKXEICQDY-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.22 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|