C41H83N5O3 — CID 90978908
3-[3-[bis[3-oxo-3-(2,2,4,4-tetramethylpentylamino)propyl]amino]propyl-methylamino]-N-(2,2,4,4-tetramethylhexyl)propanamide (PubChem CID 90978908) has the molecular formula C41H83N5O3 and a molecular weight of 694.15 g/mol. Its IUPAC name is 3-[3-[bis[3-oxo-3-(2,2,4,4-tetramethylpentylamino)propyl]amino]propyl-methylamino]-N-(2,2,4,4-tetramethylhexyl)propanamide.
| Compound Name | 3-[3-[bis[3-oxo-3-(2,2,4,4-tetramethylpentylamino)propyl]amino]propyl-methylamino]-N-(2,2,4,4-tetramethylhexyl)propanamide |
|---|---|
| PubChem CID | 90978908 |
| Molecular Formula | C41H83N5O3 |
| Molecular Weight | 694.15 g/mol |
| Exact Mass | 693.65 |
| IUPAC Name | 3-[3-[bis[3-oxo-3-(2,2,4,4-tetramethylpentylamino)propyl]amino]propyl-methylamino]-N-(2,2,4,4-tetramethylhexyl)propanamide |
| SMILES | CCC(C)(C)CC(C)(C)CNC(=O)CCN(C)CCCN(CCC(=O)NCC(C)(C)CC(C)(C)C)CCC(=O)NCC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C41H83N5O3/c1-17-38(8,9)29-41(14,15)32-44-33(47)19-24-45(16)22-18-23-46(25-20-34(48)42-30-39(10,11)27-36(2,3)4)26-21-35(49)43-31-40(12,13)28-37(5,6)7/h17-32H2,1-16H3,(H,42,48)(H,43,49)(H,44,47) |
| InChIKey | CDXKOHCIWICBDW-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.15 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |