C54H40F26O4S2 — CID 90981258
bis[2,4-dimethyl-6-[phenyl(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanyl)methyl]phenyl] benzene-1,4-dicarboxylate (PubChem CID 90981258) has the molecular formula C54H40F26O4S2 and a molecular weight of 1310.99 g/mol. Its IUPAC name is bis[2,4-dimethyl-6-[phenyl(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanyl)methyl]phenyl] benzene-1,4-dicarboxylate.
| Compound Name | bis[2,4-dimethyl-6-[phenyl(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanyl)methyl]phenyl] benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 90981258 |
| Molecular Formula | C54H40F26O4S2 |
| Molecular Weight | 1310.99 g/mol |
| Exact Mass | 1310.20 |
| IUPAC Name | bis[2,4-dimethyl-6-[phenyl(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanyl)methyl]phenyl] benzene-1,4-dicarboxylate |
| SMILES | Cc1cc(C)c(OC(=O)c2ccc(C(=O)Oc3c(C)cc(C)cc3C(SCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c3ccccc3)cc2)c(C(SCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c2ccccc2)c1 |
| InChI | InChI=1S/C54H40F26O4S2/c1-27-23-29(3)37(35(25-27)39(31-11-7-5-8-12-31)85-21-19-43(55,56)45(59,60)47(63,64)49(67,68)51(71,72)53(75,76)77)83-41(81)33-15-17-34(18-16-33)42(82)84-38-30(4)24-28(2)26-36(38)40(32-13-9-6-10-14-32)86-22-20-44(57,58)46(61,62)48(65,66)50(69,70)52(73,74)54(78,79)80/h5-18,23-26,39-40H,19-22H2,1-4H3 |
| InChIKey | JNRQYUALAAUZOH-UHFFFAOYSA-N |
| XLogP | 19.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 86 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1310.99 |
| LogP ≤ 5 | 19.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|