C10H14N2O4S — CID 90984482
3-ethyl-2,4-dioxo-1-thia-3,9-diazaspiro[4.5]decane-9-carboxylic acid (PubChem CID 90984482) has the molecular formula C10H14N2O4S and a molecular weight of 258.30 g/mol. Its IUPAC name is 3-ethyl-2,4-dioxo-1-thia-3,9-diazaspiro[4.5]decane-9-carboxylic acid.
| Compound Name | 3-ethyl-2,4-dioxo-1-thia-3,9-diazaspiro[4.5]decane-9-carboxylic acid |
|---|---|
| PubChem CID | 90984482 |
| Molecular Formula | C10H14N2O4S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 3-ethyl-2,4-dioxo-1-thia-3,9-diazaspiro[4.5]decane-9-carboxylic acid |
| SMILES | CCN1C(=O)SC2(CCCN(C(=O)O)C2)C1=O |
| InChI | InChI=1S/C10H14N2O4S/c1-2-12-7(13)10(17-9(12)16)4-3-5-11(6-10)8(14)15/h2-6H2,1H3,(H,14,15) |
| InChIKey | SPLZHVZTMASBRP-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|