C16H25NO3 — CID 90991112
(1-hydroxy-2-methyl-3-phenylpropan-2-yl) N-tert-butyl-N-methylcarbamate (PubChem CID 90991112) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is (1-hydroxy-2-methyl-3-phenylpropan-2-yl) N-tert-butyl-N-methylcarbamate.
| Compound Name | (1-hydroxy-2-methyl-3-phenylpropan-2-yl) N-tert-butyl-N-methylcarbamate |
|---|---|
| PubChem CID | 90991112 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | (1-hydroxy-2-methyl-3-phenylpropan-2-yl) N-tert-butyl-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(CO)Cc1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C16H25NO3/c1-15(2,3)17(5)14(19)20-16(4,12-18)11-13-9-7-6-8-10-13/h6-10,18H,11-12H2,1-5H3 |
| InChIKey | JENVWDDCTOTRRC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |