C23H31N3O2 — CID 90991334
1-[4-(3,4,5,9,10,10a-hexahydro-1H-pyrido[1,2-a][1,4]diazepin-2-yl)butyl]-3,4-dihydro-1-benzazepine-2,5-dione (PubChem CID 90991334) has the molecular formula C23H31N3O2 and a molecular weight of 381.52 g/mol. Its IUPAC name is 1-[4-(3,4,5,9,10,10a-hexahydro-1H-pyrido[1,2-a][1,4]diazepin-2-yl)butyl]-3,4-dihydro-1-benzazepine-2,5-dione.
| Compound Name | 1-[4-(3,4,5,9,10,10a-hexahydro-1H-pyrido[1,2-a][1,4]diazepin-2-yl)butyl]-3,4-dihydro-1-benzazepine-2,5-dione |
|---|---|
| PubChem CID | 90991334 |
| Molecular Formula | C23H31N3O2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | 1-[4-(3,4,5,9,10,10a-hexahydro-1H-pyrido[1,2-a][1,4]diazepin-2-yl)butyl]-3,4-dihydro-1-benzazepine-2,5-dione |
| SMILES | O=C1CCC(=O)N(CCCCN2CCCN3C=CCCC3C2)c2ccccc21 |
| InChI | InChI=1S/C23H31N3O2/c27-22-11-12-23(28)26(21-10-2-1-9-20(21)22)17-6-5-13-24-14-7-16-25-15-4-3-8-19(25)18-24/h1-2,4,9-10,15,19H,3,5-8,11-14,16-18H2 |
| InChIKey | LGRYDAYPHYDPJF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|