C27H38F3N3O4 — CID 68583652
1-[4-[4-(cyclohexylmethyl)piperazin-1-ium-1-yl]butyl]-3,4-dihydro-1-benzazepine-2,5-dione;2,2,2-trifluoroacetate (PubChem CID 68583652) has the molecular formula C27H38F3N3O4 and a molecular weight of 525.61 g/mol. Its IUPAC name is 1-[4-[4-(cyclohexylmethyl)piperazin-1-ium-1-yl]butyl]-3,4-dihydro-1-benzazepine-2,5-dione;2,2,2-trifluoroacetate.
| Compound Name | 1-[4-[4-(cyclohexylmethyl)piperazin-1-ium-1-yl]butyl]-3,4-dihydro-1-benzazepine-2,5-dione;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 68583652 |
| Molecular Formula | C27H38F3N3O4 |
| Molecular Weight | 525.61 g/mol |
| Exact Mass | 525.28 |
| IUPAC Name | 1-[4-[4-(cyclohexylmethyl)piperazin-1-ium-1-yl]butyl]-3,4-dihydro-1-benzazepine-2,5-dione;2,2,2-trifluoroacetate |
| SMILES | O=C([O-])C(F)(F)F.O=C1CCC(=O)N(CCCC[NH+]2CCN(CC3CCCCC3)CC2)c2ccccc21 |
| InChI | InChI=1S/C25H37N3O2.C2HF3O2/c29-24-12-13-25(30)28(23-11-5-4-10-22(23)24)15-7-6-14-26-16-18-27(19-17-26)20-21-8-2-1-3-9-21;3-2(4,5)1(6)7/h4-5,10-11,21H,1-3,6-9,12-20H2;(H,6,7) |
| InChIKey | UCQOVHOZJOVRKU-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.61 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|