C23H32F3N3O5 — CID 68583837
1-[4-[4-(2-methoxyethyl)piperazin-1-ium-1-yl]butyl]-3,4-dihydro-1-benzazepine-2,5-dione;2,2,2-trifluoroacetate (PubChem CID 68583837) has the molecular formula C23H32F3N3O5 and a molecular weight of 487.52 g/mol. Its IUPAC name is 1-[4-[4-(2-methoxyethyl)piperazin-1-ium-1-yl]butyl]-3,4-dihydro-1-benzazepine-2,5-dione;2,2,2-trifluoroacetate.
| Compound Name | 1-[4-[4-(2-methoxyethyl)piperazin-1-ium-1-yl]butyl]-3,4-dihydro-1-benzazepine-2,5-dione;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 68583837 |
| Molecular Formula | C23H32F3N3O5 |
| Molecular Weight | 487.52 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | 1-[4-[4-(2-methoxyethyl)piperazin-1-ium-1-yl]butyl]-3,4-dihydro-1-benzazepine-2,5-dione;2,2,2-trifluoroacetate |
| SMILES | COCCN1CC[NH+](CCCCN2C(=O)CCC(=O)c3ccccc32)CC1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C21H31N3O3.C2HF3O2/c1-27-17-16-23-14-12-22(13-15-23)10-4-5-11-24-19-7-3-2-6-18(19)20(25)8-9-21(24)26;3-2(4,5)1(6)7/h2-3,6-7H,4-5,8-17H2,1H3;(H,6,7) |
| InChIKey | ASHOIZYUVCTOMT-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 94.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.52 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|