C22H29F3N3O4+ — CID 91040798
[1-[4-(2,5-dioxo-3,4-dihydro-1-benzazepin-1-yl)butyl]-4-methyl-1,4-diazepan-1-ium-1-yl] 2,2,2-trifluoroacetate (PubChem CID 91040798) has the molecular formula C22H29F3N3O4+ and a molecular weight of 456.49 g/mol. Its IUPAC name is [1-[4-(2,5-dioxo-3,4-dihydro-1-benzazepin-1-yl)butyl]-4-methyl-1,4-diazepan-1-ium-1-yl] 2,2,2-trifluoroacetate.
| Compound Name | [1-[4-(2,5-dioxo-3,4-dihydro-1-benzazepin-1-yl)butyl]-4-methyl-1,4-diazepan-1-ium-1-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 91040798 |
| Molecular Formula | C22H29F3N3O4+ |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | [1-[4-(2,5-dioxo-3,4-dihydro-1-benzazepin-1-yl)butyl]-4-methyl-1,4-diazepan-1-ium-1-yl] 2,2,2-trifluoroacetate |
| SMILES | CN1CCC[N+](CCCCN2C(=O)CCC(=O)c3ccccc32)(OC(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C22H29F3N3O4/c1-26-11-6-15-28(16-13-26,32-21(31)22(23,24)25)14-5-4-12-27-18-8-3-2-7-17(18)19(29)9-10-20(27)30/h2-3,7-8H,4-6,9-16H2,1H3/q+1 |
| InChIKey | BXKJXDGYBBEWSH-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|