C42H39ClF3N3O2 — CID 91001428
N-benzyl-2-[5-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]indol-1-yl]acetamide (PubChem CID 91001428) has the molecular formula C42H39ClF3N3O2 and a molecular weight of 710.24 g/mol. Its IUPAC name is N-benzyl-2-[5-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]indol-1-yl]acetamide.
| Compound Name | N-benzyl-2-[5-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]indol-1-yl]acetamide |
|---|---|
| PubChem CID | 91001428 |
| Molecular Formula | C42H39ClF3N3O2 |
| Molecular Weight | 710.24 g/mol |
| Exact Mass | 709.27 |
| IUPAC Name | N-benzyl-2-[5-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]indol-1-yl]acetamide |
| SMILES | O=C(Cn1ccc2cc(OCCCN(Cc3cccc(C(F)(F)F)c3Cl)CC(c3ccccc3)c3ccccc3)ccc21)NCc1ccccc1 |
| InChI | InChI=1S/C42H39ClF3N3O2/c43-41-35(18-10-19-38(41)42(44,45)46)28-48(29-37(32-14-6-2-7-15-32)33-16-8-3-9-17-33)23-11-25-51-36-20-21-39-34(26-36)22-24-49(39)30-40(50)47-27-31-12-4-1-5-13-31/h1-10,12-22,24,26,37H,11,23,25,27-30H2,(H,47,50) |
| InChIKey | WDOTWPHXZUQXSO-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.24 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|