C18H16N2O2S — CID 91007128
benzyl (1S,3S)-3-isothiocyanato-1,2,3,4-tetrahydroisoquinoline-1-carboxylate (PubChem CID 91007128) has the molecular formula C18H16N2O2S and a molecular weight of 324.41 g/mol. Its IUPAC name is benzyl (1S,3S)-3-isothiocyanato-1,2,3,4-tetrahydroisoquinoline-1-carboxylate.
| Compound Name | benzyl (1S,3S)-3-isothiocyanato-1,2,3,4-tetrahydroisoquinoline-1-carboxylate |
|---|---|
| PubChem CID | 91007128 |
| Molecular Formula | C18H16N2O2S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | benzyl (1S,3S)-3-isothiocyanato-1,2,3,4-tetrahydroisoquinoline-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)[C@H]1N[C@@H](N=C=S)Cc2ccccc21 |
| InChI | InChI=1S/C18H16N2O2S/c21-18(22-11-13-6-2-1-3-7-13)17-15-9-5-4-8-14(15)10-16(20-17)19-12-23/h1-9,16-17,20H,10-11H2/t16-,17+/m1/s1 |
| InChIKey | NLVSEFHOEQNVLG-SJORKVTESA-N |
| XLogP | 3.05 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|