C15H28N6O6S2 — CID 91014089
(1-aminoethylideneamino) 2-amino-3-[[(2R)-3-(1-aminoethylideneamino)oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]disulfanyl]propanoate (PubChem CID 91014089) has the molecular formula C15H28N6O6S2 and a molecular weight of 452.56 g/mol. Its IUPAC name is (1-aminoethylideneamino) 2-amino-3-[[(2R)-3-(1-aminoethylideneamino)oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]disulfanyl]propanoate.
| Compound Name | (1-aminoethylideneamino) 2-amino-3-[[(2R)-3-(1-aminoethylideneamino)oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]disulfanyl]propanoate |
|---|---|
| PubChem CID | 91014089 |
| Molecular Formula | C15H28N6O6S2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | (1-aminoethylideneamino) 2-amino-3-[[(2R)-3-(1-aminoethylideneamino)oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]disulfanyl]propanoate |
| SMILES | CC(N)=NOC(=O)C(N)CSSC[C@H](NC(=O)OC(C)(C)C)C(=O)ON=C(C)N |
| InChI | InChI=1S/C15H28N6O6S2/c1-8(16)20-26-12(22)10(18)6-28-29-7-11(13(23)27-21-9(2)17)19-14(24)25-15(3,4)5/h10-11H,6-7,18H2,1-5H3,(H2,16,20)(H2,17,21)(H,19,24)/t10?,11-/m0/s1 |
| InChIKey | BBNWRUKXVCGESU-DTIOYNMSSA-N |
| XLogP | 0.26 |
| TPSA | 193.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|