C5H8N2O — CID 91015204
2-methyl-1,3-dihydropyridazin-6-one (PubChem CID 91015204) has the molecular formula C5H8N2O and a molecular weight of 112.13 g/mol. Its IUPAC name is 2-methyl-1,3-dihydropyridazin-6-one.
| Compound Name | 2-methyl-1,3-dihydropyridazin-6-one |
|---|---|
| PubChem CID | 91015204 |
| Molecular Formula | C5H8N2O |
| Molecular Weight | 112.13 g/mol |
| Exact Mass | 112.06 |
| IUPAC Name | 2-methyl-1,3-dihydropyridazin-6-one |
| SMILES | CN1CC=CC(=O)N1 |
| InChI | InChI=1S/C5H8N2O/c1-7-4-2-3-5(8)6-7/h2-3H,4H2,1H3,(H,6,8) |
| InChIKey | YRAPMBPNZLGJOB-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.13 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |