C18H17Cl2NO — CID 91015643
3-[2-(2,4-dichlorophenoxy)ethyl]-4,5-dihydro-3H-1-benzazepine (PubChem CID 91015643) has the molecular formula C18H17Cl2NO and a molecular weight of 334.25 g/mol. Its IUPAC name is 3-[2-(2,4-dichlorophenoxy)ethyl]-4,5-dihydro-3H-1-benzazepine.
| Compound Name | 3-[2-(2,4-dichlorophenoxy)ethyl]-4,5-dihydro-3H-1-benzazepine |
|---|---|
| PubChem CID | 91015643 |
| Molecular Formula | C18H17Cl2NO |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 3-[2-(2,4-dichlorophenoxy)ethyl]-4,5-dihydro-3H-1-benzazepine |
| SMILES | Clc1ccc(OCCC2C=Nc3ccccc3CC2)c(Cl)c1 |
| InChI | InChI=1S/C18H17Cl2NO/c19-15-7-8-18(16(20)11-15)22-10-9-13-5-6-14-3-1-2-4-17(14)21-12-13/h1-4,7-8,11-13H,5-6,9-10H2 |
| InChIKey | HOBSMSYBYVKCLJ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |