C23H19N3O9 — CID 91031022
[2-(hydrazinecarbonyl)-4-hydroxy-3-nitrobenzoyl] 3-(3-but-2-en-2-yloxyphenyl)furan-2-carboxylate (PubChem CID 91031022) has the molecular formula C23H19N3O9 and a molecular weight of 481.42 g/mol. Its IUPAC name is [2-(hydrazinecarbonyl)-4-hydroxy-3-nitrobenzoyl] 3-(3-but-2-en-2-yloxyphenyl)furan-2-carboxylate.
| Compound Name | [2-(hydrazinecarbonyl)-4-hydroxy-3-nitrobenzoyl] 3-(3-but-2-en-2-yloxyphenyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 91031022 |
| Molecular Formula | C23H19N3O9 |
| Molecular Weight | 481.42 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | [2-(hydrazinecarbonyl)-4-hydroxy-3-nitrobenzoyl] 3-(3-but-2-en-2-yloxyphenyl)furan-2-carboxylate |
| SMILES | CC=C(C)Oc1cccc(-c2ccoc2C(=O)OC(=O)c2ccc(O)c([N+](=O)[O-])c2C(=O)NN)c1 |
| InChI | InChI=1S/C23H19N3O9/c1-3-12(2)34-14-6-4-5-13(11-14)15-9-10-33-20(15)23(30)35-22(29)16-7-8-17(27)19(26(31)32)18(16)21(28)25-24/h3-11,27H,24H2,1-2H3,(H,25,28) |
| InChIKey | PHMDSASRJQOOKP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 184.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|