C24H21N3O7 — CID 87604366
[3-cyano-2-(hydrazinecarbonyl)-4-hydroxybenzoyl] 3-(3-butoxyphenyl)furan-2-carboxylate (PubChem CID 87604366) has the molecular formula C24H21N3O7 and a molecular weight of 463.45 g/mol. Its IUPAC name is [3-cyano-2-(hydrazinecarbonyl)-4-hydroxybenzoyl] 3-(3-butoxyphenyl)furan-2-carboxylate.
| Compound Name | [3-cyano-2-(hydrazinecarbonyl)-4-hydroxybenzoyl] 3-(3-butoxyphenyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 87604366 |
| Molecular Formula | C24H21N3O7 |
| Molecular Weight | 463.45 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | [3-cyano-2-(hydrazinecarbonyl)-4-hydroxybenzoyl] 3-(3-butoxyphenyl)furan-2-carboxylate |
| SMILES | CCCCOc1cccc(-c2ccoc2C(=O)OC(=O)c2ccc(O)c(C#N)c2C(=O)NN)c1 |
| InChI | InChI=1S/C24H21N3O7/c1-2-3-10-32-15-6-4-5-14(12-15)16-9-11-33-21(16)24(31)34-23(30)17-7-8-19(28)18(13-25)20(17)22(29)27-26/h4-9,11-12,28H,2-3,10,26H2,1H3,(H,27,29) |
| InChIKey | LMWRAZJZNKPMFR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 164.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.45 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|