C26H19N3O8 — CID 87605024
[2-(hydrazinecarbonyl)-4-methoxy-3-nitrobenzoyl] 3,4-diphenylfuran-2-carboxylate (PubChem CID 87605024) has the molecular formula C26H19N3O8 and a molecular weight of 501.45 g/mol. Its IUPAC name is [2-(hydrazinecarbonyl)-4-methoxy-3-nitrobenzoyl] 3,4-diphenylfuran-2-carboxylate.
| Compound Name | [2-(hydrazinecarbonyl)-4-methoxy-3-nitrobenzoyl] 3,4-diphenylfuran-2-carboxylate |
|---|---|
| PubChem CID | 87605024 |
| Molecular Formula | C26H19N3O8 |
| Molecular Weight | 501.45 g/mol |
| Exact Mass | 501.12 |
| IUPAC Name | [2-(hydrazinecarbonyl)-4-methoxy-3-nitrobenzoyl] 3,4-diphenylfuran-2-carboxylate |
| SMILES | COc1ccc(C(=O)OC(=O)c2occ(-c3ccccc3)c2-c2ccccc2)c(C(=O)NN)c1[N+](=O)[O-] |
| InChI | InChI=1S/C26H19N3O8/c1-35-19-13-12-17(21(24(30)28-27)22(19)29(33)34)25(31)37-26(32)23-20(16-10-6-3-7-11-16)18(14-36-23)15-8-4-2-5-9-15/h2-14H,27H2,1H3,(H,28,30) |
| InChIKey | FKMULLSDUYJLTJ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 164.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|