C28H34N2O9 — CID 91033678
(4R,4aS,5R,5aS,6S,12aR)-7-acetyl-9-tert-butyl-4-(dimethylamino)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91033678) has the molecular formula C28H34N2O9 and a molecular weight of 542.59 g/mol. Its IUPAC name is (4R,4aS,5R,5aS,6S,12aR)-7-acetyl-9-tert-butyl-4-(dimethylamino)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4R,4aS,5R,5aS,6S,12aR)-7-acetyl-9-tert-butyl-4-(dimethylamino)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91033678 |
| Molecular Formula | C28H34N2O9 |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 542.23 |
| IUPAC Name | (4R,4aS,5R,5aS,6S,12aR)-7-acetyl-9-tert-butyl-4-(dimethylamino)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CC(=O)c1cc(C(C)(C)C)c(O)c2c1[C@@H](C)[C@H]1C(C2=O)C(=O)[C@@]2(O)C(=O)C(C(N)=O)C(=O)[C@H](N(C)C)[C@H]2[C@@H]1O |
| InChI | InChI=1S/C28H34N2O9/c1-9-13-11(10(2)31)8-12(27(3,4)5)20(32)15(13)21(33)16-14(9)22(34)18-19(30(6)7)23(35)17(26(29)38)25(37)28(18,39)24(16)36/h8-9,14,16-19,22,32,34,39H,1-7H3,(H2,29,38)/t9-,14+,16?,17?,18+,19-,22-,28-/m1/s1 |
| InChIKey | HATWYOZTKGHDLK-VCGNNCMGSA-N |
| XLogP | -0.10 |
| TPSA | 192.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|