C29H38N2O8 — CID 123742486
9-tert-butyl-4-(dimethylamino)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-7-propyl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 123742486) has the molecular formula C29H38N2O8 and a molecular weight of 542.63 g/mol. Its IUPAC name is 9-tert-butyl-4-(dimethylamino)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-7-propyl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | 9-tert-butyl-4-(dimethylamino)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-7-propyl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 123742486 |
| Molecular Formula | C29H38N2O8 |
| Molecular Weight | 542.63 g/mol |
| Exact Mass | 542.26 |
| IUPAC Name | 9-tert-butyl-4-(dimethylamino)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-7-propyl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CCCc1cc(C(C)(C)C)c(O)c2c1C(C)C1C(C2=O)C(=O)C2(O)C(=O)C(C(N)=O)C(=O)C(N(C)C)C2C1O |
| InChI | InChI=1S/C29H38N2O8/c1-8-9-12-10-13(28(3,4)5)21(32)16-14(12)11(2)15-17(22(16)33)25(36)29(39)19(23(15)34)20(31(6)7)24(35)18(26(29)37)27(30)38/h10-11,15,17-20,23,32,34,39H,8-9H2,1-7H3,(H2,30,38) |
| InChIKey | NFWPGCLHOSPYQL-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 175.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.63 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|