C14H24N2OS — CID 91033920
5-(2-ethoxyphenyl)-4-methylsulfanylpentane-1,2-diamine (PubChem CID 91033920) has the molecular formula C14H24N2OS and a molecular weight of 268.43 g/mol. Its IUPAC name is 5-(2-ethoxyphenyl)-4-methylsulfanylpentane-1,2-diamine.
| Compound Name | 5-(2-ethoxyphenyl)-4-methylsulfanylpentane-1,2-diamine |
|---|---|
| PubChem CID | 91033920 |
| Molecular Formula | C14H24N2OS |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 5-(2-ethoxyphenyl)-4-methylsulfanylpentane-1,2-diamine |
| SMILES | CCOc1ccccc1CC(CC(N)CN)SC |
| InChI | InChI=1S/C14H24N2OS/c1-3-17-14-7-5-4-6-11(14)8-13(18-2)9-12(16)10-15/h4-7,12-13H,3,8-10,15-16H2,1-2H3 |
| InChIKey | POHOMLAZOZJHOY-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |