C31H57NO5 — CID 91036488
N-[6-ethyl-4,5-dimethyl-2-[4,4,5-trimethyl-2-(2,3,4,5,6-pentamethylcyclohexyl)oxyoxolan-3-yl]oxyoxan-3-yl]-N-methylpropanamide (PubChem CID 91036488) has the molecular formula C31H57NO5 and a molecular weight of 523.80 g/mol. Its IUPAC name is N-[6-ethyl-4,5-dimethyl-2-[4,4,5-trimethyl-2-(2,3,4,5,6-pentamethylcyclohexyl)oxyoxolan-3-yl]oxyoxan-3-yl]-N-methylpropanamide.
| Compound Name | N-[6-ethyl-4,5-dimethyl-2-[4,4,5-trimethyl-2-(2,3,4,5,6-pentamethylcyclohexyl)oxyoxolan-3-yl]oxyoxan-3-yl]-N-methylpropanamide |
|---|---|
| PubChem CID | 91036488 |
| Molecular Formula | C31H57NO5 |
| Molecular Weight | 523.80 g/mol |
| Exact Mass | 523.42 |
| IUPAC Name | N-[6-ethyl-4,5-dimethyl-2-[4,4,5-trimethyl-2-(2,3,4,5,6-pentamethylcyclohexyl)oxyoxolan-3-yl]oxyoxan-3-yl]-N-methylpropanamide |
| SMILES | CCC(=O)N(C)C1C(OC2C(OC3C(C)C(C)C(C)C(C)C3C)OC(C)C2(C)C)OC(CC)C(C)C1C |
| InChI | InChI=1S/C31H57NO5/c1-14-24-19(6)20(7)26(32(13)25(33)15-2)29(35-24)37-28-30(34-23(10)31(28,11)12)36-27-21(8)17(4)16(3)18(5)22(27)9/h16-24,26-30H,14-15H2,1-13H3 |
| InChIKey | FTUYQCCNGVCACT-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.80 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |