C22H14ClN3O5S2 — CID 91044087
1-(4-chlorophenyl)-5-[[2-[2-(4-methyl-3-nitrofuran-2-yl)ethenyl]thiophen-3-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 91044087) has the molecular formula C22H14ClN3O5S2 and a molecular weight of 499.96 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-5-[[2-[2-(4-methyl-3-nitrofuran-2-yl)ethenyl]thiophen-3-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 1-(4-chlorophenyl)-5-[[2-[2-(4-methyl-3-nitrofuran-2-yl)ethenyl]thiophen-3-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 91044087 |
| Molecular Formula | C22H14ClN3O5S2 |
| Molecular Weight | 499.96 g/mol |
| Exact Mass | 499.01 |
| IUPAC Name | 1-(4-chlorophenyl)-5-[[2-[2-(4-methyl-3-nitrofuran-2-yl)ethenyl]thiophen-3-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | Cc1coc(C=Cc2sccc2C=C2C(=O)NC(=S)N(c3ccc(Cl)cc3)C2=O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C22H14ClN3O5S2/c1-12-11-31-17(19(12)26(29)30)6-7-18-13(8-9-33-18)10-16-20(27)24-22(32)25(21(16)28)15-4-2-14(23)3-5-15/h2-11H,1H3,(H,24,27,32) |
| InChIKey | XNKVVKLLAJKVJE-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 105.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.96 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|