C20H18O7 — CID 91048660
(2S,3R)-2,3-dibenzyl-3-carbonoperoxoyl-5-oxooxolane-2-carboxylic acid (PubChem CID 91048660) has the molecular formula C20H18O7 and a molecular weight of 370.36 g/mol. Its IUPAC name is (2S,3R)-2,3-dibenzyl-3-carbonoperoxoyl-5-oxooxolane-2-carboxylic acid.
| Compound Name | (2S,3R)-2,3-dibenzyl-3-carbonoperoxoyl-5-oxooxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 91048660 |
| Molecular Formula | C20H18O7 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | (2S,3R)-2,3-dibenzyl-3-carbonoperoxoyl-5-oxooxolane-2-carboxylic acid |
| SMILES | O=C1C[C@@](Cc2ccccc2)(C(=O)OO)[C@@](Cc2ccccc2)(C(=O)O)O1 |
| InChI | InChI=1S/C20H18O7/c21-16-13-19(18(24)27-25,11-14-7-3-1-4-8-14)20(26-16,17(22)23)12-15-9-5-2-6-10-15/h1-10,25H,11-13H2,(H,22,23)/t19-,20+/m0/s1 |
| InChIKey | UYLDDMCFLBPXQN-VQTJNVASSA-N |
| XLogP | 2.24 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|