C27H28O5 — CID 91051200
ethyl 2-[2-[4-(3-hydroxyphenoxy)butoxy]-9H-fluoren-9-yl]acetate (PubChem CID 91051200) has the molecular formula C27H28O5 and a molecular weight of 432.52 g/mol. Its IUPAC name is ethyl 2-[2-[4-(3-hydroxyphenoxy)butoxy]-9H-fluoren-9-yl]acetate.
| Compound Name | ethyl 2-[2-[4-(3-hydroxyphenoxy)butoxy]-9H-fluoren-9-yl]acetate |
|---|---|
| PubChem CID | 91051200 |
| Molecular Formula | C27H28O5 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | ethyl 2-[2-[4-(3-hydroxyphenoxy)butoxy]-9H-fluoren-9-yl]acetate |
| SMILES | CCOC(=O)CC1c2ccccc2-c2ccc(OCCCCOc3cccc(O)c3)cc21 |
| InChI | InChI=1S/C27H28O5/c1-2-30-27(29)18-26-23-11-4-3-10-22(23)24-13-12-21(17-25(24)26)32-15-6-5-14-31-20-9-7-8-19(28)16-20/h3-4,7-13,16-17,26,28H,2,5-6,14-15,18H2,1H3 |
| InChIKey | ZUYVYQLPJVODJC-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|