C23H23ClIN5O2 — CID 91056817
2-[(4-chlorophenyl)carbamoylamino]-N-[4-(2,2-dimethylhydrazinyl)phenyl]-2-(2-iodophenyl)acetamide (PubChem CID 91056817) has the molecular formula C23H23ClIN5O2 and a molecular weight of 563.83 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)carbamoylamino]-N-[4-(2,2-dimethylhydrazinyl)phenyl]-2-(2-iodophenyl)acetamide.
| Compound Name | 2-[(4-chlorophenyl)carbamoylamino]-N-[4-(2,2-dimethylhydrazinyl)phenyl]-2-(2-iodophenyl)acetamide |
|---|---|
| PubChem CID | 91056817 |
| Molecular Formula | C23H23ClIN5O2 |
| Molecular Weight | 563.83 g/mol |
| Exact Mass | 563.06 |
| IUPAC Name | 2-[(4-chlorophenyl)carbamoylamino]-N-[4-(2,2-dimethylhydrazinyl)phenyl]-2-(2-iodophenyl)acetamide |
| SMILES | CN(C)Nc1ccc(NC(=O)C(NC(=O)Nc2ccc(Cl)cc2)c2ccccc2I)cc1 |
| InChI | InChI=1S/C23H23ClIN5O2/c1-30(2)29-18-13-11-16(12-14-18)26-22(31)21(19-5-3-4-6-20(19)25)28-23(32)27-17-9-7-15(24)8-10-17/h3-14,21,29H,1-2H3,(H,26,31)(H2,27,28,32) |
| InChIKey | IQZDCLMMEOVUCA-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 85.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.83 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|