C19H21N3O2S — CID 91056826
N-benzyl-2-[2-(2-bicyclo[2.2.1]hept-5-enylamino)-4-hydroxy-1,3-thiazol-5-yl]acetamide (PubChem CID 91056826) has the molecular formula C19H21N3O2S and a molecular weight of 355.46 g/mol. Its IUPAC name is N-benzyl-2-[2-(2-bicyclo[2.2.1]hept-5-enylamino)-4-hydroxy-1,3-thiazol-5-yl]acetamide.
| Compound Name | N-benzyl-2-[2-(2-bicyclo[2.2.1]hept-5-enylamino)-4-hydroxy-1,3-thiazol-5-yl]acetamide |
|---|---|
| PubChem CID | 91056826 |
| Molecular Formula | C19H21N3O2S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | N-benzyl-2-[2-(2-bicyclo[2.2.1]hept-5-enylamino)-4-hydroxy-1,3-thiazol-5-yl]acetamide |
| SMILES | O=C(Cc1sc(NC2CC3C=CC2C3)nc1O)NCc1ccccc1 |
| InChI | InChI=1S/C19H21N3O2S/c23-17(20-11-12-4-2-1-3-5-12)10-16-18(24)22-19(25-16)21-15-9-13-6-7-14(15)8-13/h1-7,13-15,24H,8-11H2,(H,20,23)(H,21,22) |
| InChIKey | IZNGPTWXRIUCCO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|