C23H19N — CID 91058066
[2-[2-(2-methylcyclopenta-1,3-dien-1-yl)phenyl]naphthalen-1-yl]methanimine (PubChem CID 91058066) has the molecular formula C23H19N and a molecular weight of 309.41 g/mol. Its IUPAC name is [2-[2-(2-methylcyclopenta-1,3-dien-1-yl)phenyl]naphthalen-1-yl]methanimine.
| Compound Name | [2-[2-(2-methylcyclopenta-1,3-dien-1-yl)phenyl]naphthalen-1-yl]methanimine |
|---|---|
| PubChem CID | 91058066 |
| Molecular Formula | C23H19N |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | [2-[2-(2-methylcyclopenta-1,3-dien-1-yl)phenyl]naphthalen-1-yl]methanimine |
| SMILES | [H]/N=C/c1c(-c2ccccc2C2=C(C)C=CC2)ccc2ccccc12 |
| InChI | InChI=1S/C23H19N/c1-16-7-6-12-18(16)20-10-4-5-11-21(20)22-14-13-17-8-2-3-9-19(17)23(22)15-24/h2-11,13-15,24H,12H2,1H3/b24-15+ |
| InChIKey | IGZZQGFDPFBHCV-BUVRLJJBSA-N |
| XLogP | 6.24 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|