C25H23N — CID 90836351
[2-[2-(2,3,5-trimethylcyclopenta-1,3-dien-1-yl)phenyl]naphthalen-1-yl]methanimine (PubChem CID 90836351) has the molecular formula C25H23N and a molecular weight of 337.47 g/mol. Its IUPAC name is [2-[2-(2,3,5-trimethylcyclopenta-1,3-dien-1-yl)phenyl]naphthalen-1-yl]methanimine.
| Compound Name | [2-[2-(2,3,5-trimethylcyclopenta-1,3-dien-1-yl)phenyl]naphthalen-1-yl]methanimine |
|---|---|
| PubChem CID | 90836351 |
| Molecular Formula | C25H23N |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | [2-[2-(2,3,5-trimethylcyclopenta-1,3-dien-1-yl)phenyl]naphthalen-1-yl]methanimine |
| SMILES | [H]/N=C/c1c(-c2ccccc2C2=C(C)C(C)=CC2C)ccc2ccccc12 |
| InChI | InChI=1S/C25H23N/c1-16-14-17(2)25(18(16)3)23-11-7-6-10-21(23)22-13-12-19-8-4-5-9-20(19)24(22)15-26/h4-15,17,26H,1-3H3/b26-15+ |
| InChIKey | NXOCHTAAJDZQCQ-CVKSISIWSA-N |
| XLogP | 6.87 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|