C24H27N — CID 91117522
[2-[2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)cyclohexyl]naphthalen-1-yl]methanimine (PubChem CID 91117522) has the molecular formula C24H27N and a molecular weight of 329.49 g/mol. Its IUPAC name is [2-[2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)cyclohexyl]naphthalen-1-yl]methanimine.
| Compound Name | [2-[2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)cyclohexyl]naphthalen-1-yl]methanimine |
|---|---|
| PubChem CID | 91117522 |
| Molecular Formula | C24H27N |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | [2-[2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)cyclohexyl]naphthalen-1-yl]methanimine |
| SMILES | [H]/N=C/c1c(C2CCCCC2C2=C(C)C=C(C)C2)ccc2ccccc12 |
| InChI | InChI=1S/C24H27N/c1-16-13-17(2)23(14-16)21-10-6-5-9-20(21)22-12-11-18-7-3-4-8-19(18)24(22)15-25/h3-4,7-8,11-13,15,20-21,25H,5-6,9-10,14H2,1-2H3/b25-15+ |
| InChIKey | NBIGUGZIOBSMCR-MFKUBSTISA-N |
| XLogP | 6.78 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|