C20H15F2N — CID 91060417
N-[2,3-difluoro-4-[4-(4-methylphenyl)phenyl]phenyl]methanimine (PubChem CID 91060417) has the molecular formula C20H15F2N and a molecular weight of 307.34 g/mol. Its IUPAC name is N-[2,3-difluoro-4-[4-(4-methylphenyl)phenyl]phenyl]methanimine.
| Compound Name | N-[2,3-difluoro-4-[4-(4-methylphenyl)phenyl]phenyl]methanimine |
|---|---|
| PubChem CID | 91060417 |
| Molecular Formula | C20H15F2N |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | N-[2,3-difluoro-4-[4-(4-methylphenyl)phenyl]phenyl]methanimine |
| SMILES | C=Nc1ccc(-c2ccc(-c3ccc(C)cc3)cc2)c(F)c1F |
| InChI | InChI=1S/C20H15F2N/c1-13-3-5-14(6-4-13)15-7-9-16(10-8-15)17-11-12-18(23-2)20(22)19(17)21/h3-12H,2H2,1H3 |
| InChIKey | JBWIUPHHBCRVRB-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|