About 1-methoxyprop-1-ene;naphthalene
1-methoxyprop-1-ene;naphthalene (PubChem CID 91064977) has the molecular formula C14H16O
and a molecular weight of 200.28 g/mol. Its IUPAC name is 1-methoxyprop-1-ene;naphthalene.
Molecular Properties
| Compound Name | 1-methoxyprop-1-ene;naphthalene |
| PubChem CID | 91064977 |
| Molecular Formula | C14H16O |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 1-methoxyprop-1-ene;naphthalene |
| SMILES | CC=COC.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.C4H8O/c1-2-6-10-8-4-3-7-9(10)5-1;1-3-4-5-2/h1-8H;3-4H,1-2H3 |
| InChIKey | UZBCGOOBOLUHNT-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxyprop-1-ene;naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxyprop-1-ene;naphthalene?
The IUPAC name of 1-methoxyprop-1-ene;naphthalene (CID 91064977) is 1-methoxyprop-1-ene;naphthalene.
What is the SMILES notation for 1-methoxyprop-1-ene;naphthalene?
The canonical SMILES for 1-methoxyprop-1-ene;naphthalene is CC=COC.c1ccc2ccccc2c1.
What is the InChIKey of 1-methoxyprop-1-ene;naphthalene?
The InChIKey is UZBCGOOBOLUHNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.C4H8O/c1-2-6-10-8-4-3-7-9(10)5-1;1-3-4-5-2/h1-8H;3-4H,1-2H3.
What are the key properties of 1-methoxyprop-1-ene;naphthalene?
1-methoxyprop-1-ene;naphthalene has a molecular weight of 200.28 g/mol, XLogP of 4.01, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxyprop-1-ene;naphthalene is sourced from PubChem (CID 91064977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).