About dimethyldiazene;naphthalene;propane
dimethyldiazene;naphthalene;propane (PubChem CID 91288749) has the molecular formula C15H22N2
and a molecular weight of 230.35 g/mol. Its IUPAC name is dimethyldiazene;naphthalene;propane.
Molecular Properties
| Compound Name | dimethyldiazene;naphthalene;propane |
| PubChem CID | 91288749 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | dimethyldiazene;naphthalene;propane |
| SMILES | C/N=N/C.CCC.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.C3H8.C2H6N2/c1-2-6-10-8-4-3-7-9(10)5-1;1-3-2;1-3-4-2/h1-8H;3H2,1-2H3;1-2H3/b;;4-3+ |
| InChIKey | ZVEGFLUFRGWIKL-VJJINTEWSA-N |
| XLogP | 4.95 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze dimethyldiazene;naphthalene;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyldiazene;naphthalene;propane?
The IUPAC name of dimethyldiazene;naphthalene;propane (CID 91288749) is dimethyldiazene;naphthalene;propane.
What is the SMILES notation for dimethyldiazene;naphthalene;propane?
The canonical SMILES for dimethyldiazene;naphthalene;propane is C/N=N/C.CCC.c1ccc2ccccc2c1.
What is the InChIKey of dimethyldiazene;naphthalene;propane?
The InChIKey is ZVEGFLUFRGWIKL-VJJINTEWSA-N. The full InChI is InChI=1S/C10H8.C3H8.C2H6N2/c1-2-6-10-8-4-3-7-9(10)5-1;1-3-2;1-3-4-2/h1-8H;3H2,1-2H3;1-2H3/b;;4-3+.
What are the key properties of dimethyldiazene;naphthalene;propane?
dimethyldiazene;naphthalene;propane has a molecular weight of 230.35 g/mol, XLogP of 4.95, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyldiazene;naphthalene;propane is sourced from PubChem (CID 91288749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).