About N-methylmethanimine;naphthalene;propane
N-methylmethanimine;naphthalene;propane (PubChem CID 90934060) has the molecular formula C18H29N
and a molecular weight of 259.44 g/mol. Its IUPAC name is N-methylmethanimine;naphthalene;propane.
Molecular Properties
| Compound Name | N-methylmethanimine;naphthalene;propane |
| PubChem CID | 90934060 |
| Molecular Formula | C18H29N |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | N-methylmethanimine;naphthalene;propane |
| SMILES | C=NC.CCC.CCC.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.2C3H8.C2H5N/c1-2-6-10-8-4-3-7-9(10)5-1;3*1-3-2/h1-8H;2*3H2,1-2H3;1H2,2H3 |
| InChIKey | LQPYGQIZEDTSAR-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-methylmethanimine;naphthalene;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylmethanimine;naphthalene;propane?
The IUPAC name of N-methylmethanimine;naphthalene;propane (CID 90934060) is N-methylmethanimine;naphthalene;propane.
What is the SMILES notation for N-methylmethanimine;naphthalene;propane?
The canonical SMILES for N-methylmethanimine;naphthalene;propane is C=NC.CCC.CCC.c1ccc2ccccc2c1.
What is the InChIKey of N-methylmethanimine;naphthalene;propane?
The InChIKey is LQPYGQIZEDTSAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.2C3H8.C2H5N/c1-2-6-10-8-4-3-7-9(10)5-1;3*1-3-2/h1-8H;2*3H2,1-2H3;1H2,2H3.
What are the key properties of N-methylmethanimine;naphthalene;propane?
N-methylmethanimine;naphthalene;propane has a molecular weight of 259.44 g/mol, XLogP of 5.99, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylmethanimine;naphthalene;propane is sourced from PubChem (CID 90934060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).